C16H36N2O3 — CID 145317497
3-[3-(2-aminoethoxy)-3-methylbutoxy]-N,3-dimethylbutan-1-amine;propanal (PubChem CID 145317497) has the molecular formula C16H36N2O3 and a molecular weight of 304.48 g/mol. Its IUPAC name is 3-[3-(2-aminoethoxy)-3-methylbutoxy]-N,3-dimethylbutan-1-amine;propanal.
| Compound Name | 3-[3-(2-aminoethoxy)-3-methylbutoxy]-N,3-dimethylbutan-1-amine;propanal |
|---|---|
| PubChem CID | 145317497 |
| Molecular Formula | C16H36N2O3 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.27 |
| IUPAC Name | 3-[3-(2-aminoethoxy)-3-methylbutoxy]-N,3-dimethylbutan-1-amine;propanal |
| SMILES | CCC=O.CNCCC(C)(C)OCCC(C)(C)OCCN |
| InChI | InChI=1S/C13H30N2O2.C3H6O/c1-12(2,6-9-15-5)16-10-7-13(3,4)17-11-8-14;1-2-3-4/h15H,6-11,14H2,1-5H3;3H,2H2,1H3 |
| InChIKey | PZQFIMMXVLLRLD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|