C10H22O6P2-2 — CID 162060940
2,2-dimethylpropyl-[[(2-methylpropan-2-yl)oxy-oxidophosphoryl]methoxy]phosphinate (PubChem CID 162060940) has the molecular formula C10H22O6P2-2 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[[(2-methylpropan-2-yl)oxy-oxidophosphoryl]methoxy]phosphinate.
| Compound Name | 2,2-dimethylpropyl-[[(2-methylpropan-2-yl)oxy-oxidophosphoryl]methoxy]phosphinate |
|---|---|
| PubChem CID | 162060940 |
| Molecular Formula | C10H22O6P2-2 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2,2-dimethylpropyl-[[(2-methylpropan-2-yl)oxy-oxidophosphoryl]methoxy]phosphinate |
| SMILES | CC(C)(C)CP(=O)([O-])OCP(=O)([O-])OC(C)(C)C |
| InChI | InChI=1S/C10H24O6P2/c1-9(2,3)7-17(11,12)15-8-18(13,14)16-10(4,5)6/h7-8H2,1-6H3,(H,11,12)(H,13,14)/p-2 |
| InChIKey | YZVHQYTWVQKIMB-UHFFFAOYSA-L |
| XLogP | 1.93 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|