C26H58O7P- — CID 158753229
tert-butyl [3-(2,2-dimethylpropoxy)-2,2-bis(2,2-dimethylpropoxymethyl)propyl] phosphate;methane (PubChem CID 158753229) has the molecular formula C26H58O7P- and a molecular weight of 513.72 g/mol. Its IUPAC name is tert-butyl [3-(2,2-dimethylpropoxy)-2,2-bis(2,2-dimethylpropoxymethyl)propyl] phosphate;methane.
| Compound Name | tert-butyl [3-(2,2-dimethylpropoxy)-2,2-bis(2,2-dimethylpropoxymethyl)propyl] phosphate;methane |
|---|---|
| PubChem CID | 158753229 |
| Molecular Formula | C26H58O7P- |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.39 |
| IUPAC Name | tert-butyl [3-(2,2-dimethylpropoxy)-2,2-bis(2,2-dimethylpropoxymethyl)propyl] phosphate;methane |
| SMILES | C.C.CC(C)(C)COCC(COCC(C)(C)C)(COCC(C)(C)C)COP(=O)([O-])OC(C)(C)C |
| InChI | InChI=1S/C24H51O7P.2CH4/c1-20(2,3)13-27-16-24(17-28-14-21(4,5)6,18-29-15-22(7,8)9)19-30-32(25,26)31-23(10,11)12;;/h13-19H2,1-12H3,(H,25,26);2*1H4/p-1 |
| InChIKey | INSXZLKAWBCHRM-UHFFFAOYSA-M |
| XLogP | 6.73 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|