C2H6K2O7P2 — CID 71435964
dipotassium;(1-hydroxy-1-phosphonatoethyl)phosphonic acid (PubChem CID 71435964) has the molecular formula C2H6K2O7P2 and a molecular weight of 282.21 g/mol. Its IUPAC name is dipotassium;(1-hydroxy-1-phosphonatoethyl)phosphonic acid.
| Compound Name | dipotassium;(1-hydroxy-1-phosphonatoethyl)phosphonic acid |
|---|---|
| PubChem CID | 71435964 |
| Molecular Formula | C2H6K2O7P2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 281.89 |
| IUPAC Name | dipotassium;(1-hydroxy-1-phosphonatoethyl)phosphonic acid |
| SMILES | CC(O)(P(=O)([O-])[O-])P(=O)(O)O.[K+].[K+] |
| InChI | InChI=1S/C2H8O7P2.2K/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | YGZBDWZUQFVAHU-UHFFFAOYSA-L |
| XLogP | -8.25 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | -8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|