C2H10O10P3+ — CID 88726549
dihydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid (PubChem CID 88726549) has the molecular formula C2H10O10P3+ and a molecular weight of 287.01 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid.
| Compound Name | dihydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid |
|---|---|
| PubChem CID | 88726549 |
| Molecular Formula | C2H10O10P3+ |
| Molecular Weight | 287.01 g/mol |
| Exact Mass | 286.95 |
| IUPAC Name | dihydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O.O=[P+](O)O |
| InChI | InChI=1S/C2H8O7P2.HO3P/c1-2(3,10(4,5)6)11(7,8)9;1-4(2)3/h3H,1H3,(H2,4,5,6)(H2,7,8,9);(H-,1,2,3)/p+1 |
| InChIKey | ANTIXKCANYEYIB-UHFFFAOYSA-O |
| XLogP | -1.36 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.01 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|