C2H10O9P3+ — CID 173143710
hydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid (PubChem CID 173143710) has the molecular formula C2H10O9P3+ and a molecular weight of 271.01 g/mol. Its IUPAC name is hydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid.
| Compound Name | hydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid |
|---|---|
| PubChem CID | 173143710 |
| Molecular Formula | C2H10O9P3+ |
| Molecular Weight | 271.01 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | hydroxy(oxo)phosphanium;(1-hydroxy-1-phosphonoethyl)phosphonic acid |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O.O=[PH+]O |
| InChI | InChI=1S/C2H8O7P2.HO2P/c1-2(3,10(4,5)6)11(7,8)9;1-3-2/h3H,1H3,(H2,4,5,6)(H2,7,8,9);3H/p+1 |
| InChIKey | GOWMEELYFFCNTO-UHFFFAOYSA-O |
| XLogP | -1.07 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.01 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|