C4H12O5P2 — CID 23533249
2-[dihydroxy(methylidene)-λ5-phosphanyl]propan-2-ylphosphonic acid (PubChem CID 23533249) has the molecular formula C4H12O5P2 and a molecular weight of 202.08 g/mol. Its IUPAC name is 2-[dihydroxy(methylidene)-λ5-phosphanyl]propan-2-ylphosphonic acid.
| Compound Name | 2-[dihydroxy(methylidene)-λ5-phosphanyl]propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 23533249 |
| Molecular Formula | C4H12O5P2 |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 2-[dihydroxy(methylidene)-λ5-phosphanyl]propan-2-ylphosphonic acid |
| SMILES | C=P(O)(O)C(C)(C)P(=O)(O)O |
| InChI | InChI=1S/C4H12O5P2/c1-4(2,10(3,5)6)11(7,8)9/h5-6H,3H2,1-2H3,(H2,7,8,9) |
| InChIKey | LJUNBODOJDPHQO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|