About bis(dimethylphosphinic acid);platinum
bis(dimethylphosphinic acid);platinum (PubChem CID 58918492) has the molecular formula C4H14O4P2Pt
and a molecular weight of 383.18 g/mol. Its IUPAC name is bis(dimethylphosphinic acid);platinum.
Molecular Properties
| Compound Name | bis(dimethylphosphinic acid);platinum |
| PubChem CID | 58918492 |
| Molecular Formula | C4H14O4P2Pt |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | bis(dimethylphosphinic acid);platinum |
| SMILES | CP(C)(=O)O.CP(C)(=O)O.[Pt] |
| InChI | InChI=1S/2C2H7O2P.Pt/c2*1-5(2,3)4;/h2*1-2H3,(H,3,4); |
| InChIKey | DZHLYCNCAISUTH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dimethylphosphinic acid);platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethylphosphinic acid);platinum?
The IUPAC name of bis(dimethylphosphinic acid);platinum (CID 58918492) is bis(dimethylphosphinic acid);platinum.
What is the SMILES notation for bis(dimethylphosphinic acid);platinum?
The canonical SMILES for bis(dimethylphosphinic acid);platinum is CP(C)(=O)O.CP(C)(=O)O.[Pt].
What is the InChIKey of bis(dimethylphosphinic acid);platinum?
The InChIKey is DZHLYCNCAISUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H7O2P.Pt/c2*1-5(2,3)4;/h2*1-2H3,(H,3,4);.
What are the key properties of bis(dimethylphosphinic acid);platinum?
bis(dimethylphosphinic acid);platinum has a molecular weight of 383.18 g/mol, XLogP of 1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethylphosphinic acid);platinum is sourced from PubChem (CID 58918492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).