C8H24O6P2 — CID 87843342
butane-1,4-diol;bis(dimethylphosphinic acid) (PubChem CID 87843342) has the molecular formula C8H24O6P2 and a molecular weight of 278.22 g/mol. Its IUPAC name is butane-1,4-diol;bis(dimethylphosphinic acid).
| Compound Name | butane-1,4-diol;bis(dimethylphosphinic acid) |
|---|---|
| PubChem CID | 87843342 |
| Molecular Formula | C8H24O6P2 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | butane-1,4-diol;bis(dimethylphosphinic acid) |
| SMILES | CP(C)(=O)O.CP(C)(=O)O.OCCCCO |
| InChI | InChI=1S/C4H10O2.2C2H7O2P/c5-3-1-2-4-6;2*1-5(2,3)4/h5-6H,1-4H2;2*1-2H3,(H,3,4) |
| InChIKey | IHOUORRZDOGIPT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|