C9H17O14P3 — CID 174926124
(1-hydroxy-1-phosphonoethyl)phosphonic acid;2-phosphorosobutane-1,2,4-tricarboxylic acid (PubChem CID 174926124) has the molecular formula C9H17O14P3 and a molecular weight of 442.14 g/mol. Its IUPAC name is (1-hydroxy-1-phosphonoethyl)phosphonic acid;2-phosphorosobutane-1,2,4-tricarboxylic acid.
| Compound Name | (1-hydroxy-1-phosphonoethyl)phosphonic acid;2-phosphorosobutane-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 174926124 |
| Molecular Formula | C9H17O14P3 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | (1-hydroxy-1-phosphonoethyl)phosphonic acid;2-phosphorosobutane-1,2,4-tricarboxylic acid |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O.O=PC(CCC(=O)O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H9O7P.C2H8O7P2/c8-4(9)1-2-7(15-14,6(12)13)3-5(10)11;1-2(3,10(4,5)6)11(7,8)9/h1-3H2,(H,8,9)(H,10,11)(H,12,13);3H,1H3,(H2,4,5,6)(H2,7,8,9) |
| InChIKey | NJBPPRMZMHPPBH-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 264.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|