C6H14NO11P — CID 173242667
azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid (PubChem CID 173242667) has the molecular formula C6H14NO11P and a molecular weight of 307.15 g/mol. Its IUPAC name is azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid.
| Compound Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid |
|---|---|
| PubChem CID | 173242667 |
| Molecular Formula | C6H14NO11P |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid |
| SMILES | N.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C6H8O7.H3N.H3O4P/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3;(H3,1,2,3,4) |
| InChIKey | WHSAUGWJLOEWLU-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 244.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|