azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid

C6H14NO11P — CID 173242667

IUPACazane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid
SMILESN.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=P(O)(O)O
InChIInChI=1S/C6H8O7.H3N.H3O4P/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3;(H3,1,2,3,4)
InChIKeyWHSAUGWJLOEWLU-UHFFFAOYSA-N
MW307.15 g/mol
LogP-2.02
Rot. Bonds5

About azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid

azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid (PubChem CID 173242667) has the molecular formula C6H14NO11P and a molecular weight of 307.15 g/mol. Its IUPAC name is azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid.

Molecular Properties

Compound Nameazane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid
PubChem CID173242667
Molecular FormulaC6H14NO11P
Molecular Weight307.15 g/mol
Exact Mass307.03
IUPAC Nameazane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid
SMILESN.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=P(O)(O)O
InChIInChI=1S/C6H8O7.H3N.H3O4P/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3;(H3,1,2,3,4)
InChIKeyWHSAUGWJLOEWLU-UHFFFAOYSA-N
XLogP-2.02
TPSA244.89 Ų
H-Bond Donors8
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500307.15
LogP ≤ 5-2.02
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid?
The IUPAC name of azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid (CID 173242667) is azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid.
What is the SMILES notation for azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid?
The canonical SMILES for azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid is N.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=P(O)(O)O.
What is the InChIKey of azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid?
The InChIKey is WHSAUGWJLOEWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7.H3N.H3O4P/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3;(H3,1,2,3,4).
What are the key properties of azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid?
azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid has a molecular weight of 307.15 g/mol, XLogP of -2.02, 5 rotatable bonds, 8 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-hydroxypropane-1,2,3-tricarboxylic acid;phosphoric acid is sourced from PubChem (CID 173242667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).