C5H14O7P2 — CID 54028975
[1-hydroxy-1-[hydroxy(propan-2-yloxy)phosphoryl]ethyl]phosphonic acid (PubChem CID 54028975) has the molecular formula C5H14O7P2 and a molecular weight of 248.11 g/mol. Its IUPAC name is [1-hydroxy-1-[hydroxy(propan-2-yloxy)phosphoryl]ethyl]phosphonic acid.
| Compound Name | [1-hydroxy-1-[hydroxy(propan-2-yloxy)phosphoryl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 54028975 |
| Molecular Formula | C5H14O7P2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | [1-hydroxy-1-[hydroxy(propan-2-yloxy)phosphoryl]ethyl]phosphonic acid |
| SMILES | CC(C)OP(=O)(O)C(C)(O)P(=O)(O)O |
| InChI | InChI=1S/C5H14O7P2/c1-4(2)12-14(10,11)5(3,6)13(7,8)9/h4,6H,1-3H3,(H,10,11)(H2,7,8,9) |
| InChIKey | LEFNOLYDRKQHRK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|