C8H20O9P2 — CID 101034790
[1-hydroxy-1-[hydroxy(2-hydroxypropoxy)phosphoryl]ethyl]-(2-hydroxypropoxy)phosphinic acid (PubChem CID 101034790) has the molecular formula C8H20O9P2 and a molecular weight of 322.19 g/mol. Its IUPAC name is [1-hydroxy-1-[hydroxy(2-hydroxypropoxy)phosphoryl]ethyl]-(2-hydroxypropoxy)phosphinic acid.
| Compound Name | [1-hydroxy-1-[hydroxy(2-hydroxypropoxy)phosphoryl]ethyl]-(2-hydroxypropoxy)phosphinic acid |
|---|---|
| PubChem CID | 101034790 |
| Molecular Formula | C8H20O9P2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [1-hydroxy-1-[hydroxy(2-hydroxypropoxy)phosphoryl]ethyl]-(2-hydroxypropoxy)phosphinic acid |
| SMILES | CC(O)COP(=O)(O)C(C)(O)P(=O)(O)OCC(C)O |
| InChI | InChI=1S/C8H20O9P2/c1-6(9)4-16-18(12,13)8(3,11)19(14,15)17-5-7(2)10/h6-7,9-11H,4-5H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | SHKAYQGMIVOTIR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|