C5H13O7P — CID 71750334
[(2R)-4,4,4-trideuterio-2,3-dihydroxy-3-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 71750334) has the molecular formula C5H13O7P and a molecular weight of 219.14 g/mol. Its IUPAC name is [(2R)-4,4,4-trideuterio-2,3-dihydroxy-3-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [(2R)-4,4,4-trideuterio-2,3-dihydroxy-3-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71750334 |
| Molecular Formula | C5H13O7P |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | [(2R)-4,4,4-trideuterio-2,3-dihydroxy-3-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | [2H]C([2H])([2H])C(O)(CO)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H13O7P/c1-5(8,3-6)4(7)2-12-13(9,10)11/h4,6-8H,2-3H2,1H3,(H2,9,10,11)/t4-,5?/m1/s1/i1D3 |
| InChIKey | XMWHRVNVKDKBRG-QLAZMRLXSA-N |
| XLogP | -1.80 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|