C5H13O7P — CID 54421134
[(2R,3S)-2,3-dihydroxy-4-methoxybutyl] dihydrogen phosphate (PubChem CID 54421134) has the molecular formula C5H13O7P and a molecular weight of 216.13 g/mol. Its IUPAC name is [(2R,3S)-2,3-dihydroxy-4-methoxybutyl] dihydrogen phosphate.
| Compound Name | [(2R,3S)-2,3-dihydroxy-4-methoxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54421134 |
| Molecular Formula | C5H13O7P |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | [(2R,3S)-2,3-dihydroxy-4-methoxybutyl] dihydrogen phosphate |
| SMILES | COC[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H13O7P/c1-11-2-4(6)5(7)3-12-13(8,9)10/h4-7H,2-3H2,1H3,(H2,8,9,10)/t4-,5+/m0/s1 |
| InChIKey | WAWLGNIKKYSHGW-CRCLSJGQSA-N |
| XLogP | -1.54 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|