C6H16O13P2 — CID 87275384
phosphoric acid;(2,3,6,6-tetrahydroxy-5-oxohexyl) dihydrogen phosphate (PubChem CID 87275384) has the molecular formula C6H16O13P2 and a molecular weight of 358.13 g/mol. Its IUPAC name is phosphoric acid;(2,3,6,6-tetrahydroxy-5-oxohexyl) dihydrogen phosphate.
| Compound Name | phosphoric acid;(2,3,6,6-tetrahydroxy-5-oxohexyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 87275384 |
| Molecular Formula | C6H16O13P2 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | phosphoric acid;(2,3,6,6-tetrahydroxy-5-oxohexyl) dihydrogen phosphate |
| SMILES | O=C(CC(O)C(O)COP(=O)(O)O)C(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C6H13O9P.H3O4P/c7-3(1-4(8)6(10)11)5(9)2-15-16(12,13)14;1-5(2,3)4/h3,5-7,9-11H,1-2H2,(H2,12,13,14);(H3,1,2,3,4) |
| InChIKey | PQQZFMUBBGXDIY-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 242.51 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|