C5H13O7P — CID 91528277
[(2R,3S)-3-(deuteriomethyl)-2,3,4-trihydroxybutyl] dihydrogen phosphate (PubChem CID 91528277) has the molecular formula C5H13O7P and a molecular weight of 217.13 g/mol. Its IUPAC name is [(2R,3S)-3-(deuteriomethyl)-2,3,4-trihydroxybutyl] dihydrogen phosphate.
| Compound Name | [(2R,3S)-3-(deuteriomethyl)-2,3,4-trihydroxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91528277 |
| Molecular Formula | C5H13O7P |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | [(2R,3S)-3-(deuteriomethyl)-2,3,4-trihydroxybutyl] dihydrogen phosphate |
| SMILES | [2H]C[C@](O)(CO)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H13O7P/c1-5(8,3-6)4(7)2-12-13(9,10)11/h4,6-8H,2-3H2,1H3,(H2,9,10,11)/t4-,5+/m1/s1/i1D |
| InChIKey | XMWHRVNVKDKBRG-IYAWRTBQSA-N |
| XLogP | -1.80 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|