C8H19O8P — CID 157472776
[3,4-dihydroxy-4-(hydroxymethyl)-2-oxohexyl] dihydrogen phosphate;methane (PubChem CID 157472776) has the molecular formula C8H19O8P and a molecular weight of 274.21 g/mol. Its IUPAC name is [3,4-dihydroxy-4-(hydroxymethyl)-2-oxohexyl] dihydrogen phosphate;methane.
| Compound Name | [3,4-dihydroxy-4-(hydroxymethyl)-2-oxohexyl] dihydrogen phosphate;methane |
|---|---|
| PubChem CID | 157472776 |
| Molecular Formula | C8H19O8P |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [3,4-dihydroxy-4-(hydroxymethyl)-2-oxohexyl] dihydrogen phosphate;methane |
| SMILES | C.CCC(O)(CO)C(O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C7H15O8P.CH4/c1-2-7(11,4-8)6(10)5(9)3-15-16(12,13)14;/h6,8,10-11H,2-4H2,1H3,(H2,12,13,14);1H4 |
| InChIKey | BVFWQSMIPLDHLH-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|