C3H11O7P — CID 174923679
hydroxy dihydrogen phosphate;propane-1,2-diol (PubChem CID 174923679) has the molecular formula C3H11O7P and a molecular weight of 190.09 g/mol. Its IUPAC name is hydroxy dihydrogen phosphate;propane-1,2-diol.
| Compound Name | hydroxy dihydrogen phosphate;propane-1,2-diol |
|---|---|
| PubChem CID | 174923679 |
| Molecular Formula | C3H11O7P |
| Molecular Weight | 190.09 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | hydroxy dihydrogen phosphate;propane-1,2-diol |
| SMILES | CC(O)CO.O=P(O)(O)OO |
| InChI | InChI=1S/C3H8O2.H3O5P/c1-3(5)2-4;1-5-6(2,3)4/h3-5H,2H2,1H3;1H,(H2,2,3,4) |
| InChIKey | RLAQFVHJGGLVED-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.09 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|