C6H21N5O7P2 — CID 123319908
[1-[[bis(1,2-diaminoethyl)amino]oxy-hydroxyphosphoryl]-1-hydroxyethyl]phosphonic acid (PubChem CID 123319908) has the molecular formula C6H21N5O7P2 and a molecular weight of 337.21 g/mol. Its IUPAC name is [1-[[bis(1,2-diaminoethyl)amino]oxy-hydroxyphosphoryl]-1-hydroxyethyl]phosphonic acid.
| Compound Name | [1-[[bis(1,2-diaminoethyl)amino]oxy-hydroxyphosphoryl]-1-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 123319908 |
| Molecular Formula | C6H21N5O7P2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [1-[[bis(1,2-diaminoethyl)amino]oxy-hydroxyphosphoryl]-1-hydroxyethyl]phosphonic acid |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)ON(C(N)CN)C(N)CN |
| InChI | InChI=1S/C6H21N5O7P2/c1-6(12,19(13,14)15)20(16,17)18-11(4(9)2-7)5(10)3-8/h4-5,12H,2-3,7-10H2,1H3,(H,16,17)(H2,13,14,15) |
| InChIKey | QIPRDTKCAJEIFG-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 231.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|