C13H27N3O4 — CID 22991096
ditert-butyl 2-amino-2-(1,2-diaminoethyl)propanedioate (PubChem CID 22991096) has the molecular formula C13H27N3O4 and a molecular weight of 289.38 g/mol. Its IUPAC name is ditert-butyl 2-amino-2-(1,2-diaminoethyl)propanedioate.
| Compound Name | ditert-butyl 2-amino-2-(1,2-diaminoethyl)propanedioate |
|---|---|
| PubChem CID | 22991096 |
| Molecular Formula | C13H27N3O4 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | ditert-butyl 2-amino-2-(1,2-diaminoethyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(C(=O)OC(C)(C)C)C(N)CN |
| InChI | InChI=1S/C13H27N3O4/c1-11(2,3)19-9(17)13(16,8(15)7-14)10(18)20-12(4,5)6/h8H,7,14-16H2,1-6H3 |
| InChIKey | ULSHGRXTPXYTKK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|