C13H24N2O6 — CID 174781750
2,3-diamino-7-methoxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoic acid (PubChem CID 174781750) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2,3-diamino-7-methoxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoic acid.
| Compound Name | 2,3-diamino-7-methoxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 174781750 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2,3-diamino-7-methoxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoic acid |
| SMILES | COC(=O)CCCC(N)C(N)(C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O6/c1-12(2,3)21-11(19)13(15,10(17)18)8(14)6-5-7-9(16)20-4/h8H,5-7,14-15H2,1-4H3,(H,17,18) |
| InChIKey | ASODXSPGHVLYAM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|