C13H23NO6 — CID 151139391
2-amino-3-methoxycarbonyl-2-methyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid (PubChem CID 151139391) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-amino-3-methoxycarbonyl-2-methyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid.
| Compound Name | 2-amino-3-methoxycarbonyl-2-methyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 151139391 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-amino-3-methoxycarbonyl-2-methyl-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
| SMILES | COC(=O)C(CCC(=O)OC(C)(C)C)C(C)(N)C(=O)O |
| InChI | InChI=1S/C13H23NO6/c1-12(2,3)20-9(15)7-6-8(10(16)19-5)13(4,14)11(17)18/h8H,6-7,14H2,1-5H3,(H,17,18) |
| InChIKey | MVWFMDQHZNQNBU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |