C13H23NO7 — CID 86751149
4-O-tert-butyl 1-O,1-O-dimethyl 2-amino-1-hydroxybutane-1,1,4-tricarboxylate (PubChem CID 86751149) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O,1-O-dimethyl 2-amino-1-hydroxybutane-1,1,4-tricarboxylate.
| Compound Name | 4-O-tert-butyl 1-O,1-O-dimethyl 2-amino-1-hydroxybutane-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 86751149 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-O-tert-butyl 1-O,1-O-dimethyl 2-amino-1-hydroxybutane-1,1,4-tricarboxylate |
| SMILES | COC(=O)C(O)(C(=O)OC)C(N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO7/c1-12(2,3)21-9(15)7-6-8(14)13(18,10(16)19-4)11(17)20-5/h8,18H,6-7,14H2,1-5H3 |
| InChIKey | KZAPQAWHRKQRHL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|