C9H22O7P2 — CID 123971949
2-[hydroxy(3-hydroxypentan-3-yl)phosphoryl]oxybutan-2-ylphosphonic acid (PubChem CID 123971949) has the molecular formula C9H22O7P2 and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-[hydroxy(3-hydroxypentan-3-yl)phosphoryl]oxybutan-2-ylphosphonic acid.
| Compound Name | 2-[hydroxy(3-hydroxypentan-3-yl)phosphoryl]oxybutan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 123971949 |
| Molecular Formula | C9H22O7P2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[hydroxy(3-hydroxypentan-3-yl)phosphoryl]oxybutan-2-ylphosphonic acid |
| SMILES | CCC(C)(OP(=O)(O)C(O)(CC)CC)P(=O)(O)O |
| InChI | InChI=1S/C9H22O7P2/c1-5-8(4,17(11,12)13)16-18(14,15)9(10,6-2)7-3/h10H,5-7H2,1-4H3,(H,14,15)(H2,11,12,13) |
| InChIKey | MMGLSPBKMGICBL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|