C8H20O7P2 — CID 174192214
2-[hydroxy(2-hydroxybutan-2-yl)phosphoryl]oxybutan-2-ylphosphonic acid (PubChem CID 174192214) has the molecular formula C8H20O7P2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 2-[hydroxy(2-hydroxybutan-2-yl)phosphoryl]oxybutan-2-ylphosphonic acid.
| Compound Name | 2-[hydroxy(2-hydroxybutan-2-yl)phosphoryl]oxybutan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 174192214 |
| Molecular Formula | C8H20O7P2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[hydroxy(2-hydroxybutan-2-yl)phosphoryl]oxybutan-2-ylphosphonic acid |
| SMILES | CCC(C)(OP(=O)(O)C(C)(O)CC)P(=O)(O)O |
| InChI | InChI=1S/C8H20O7P2/c1-5-7(3,9)17(13,14)15-8(4,6-2)16(10,11)12/h9H,5-6H2,1-4H3,(H,13,14)(H2,10,11,12) |
| InChIKey | VAKLOQYSJBTUGI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|