C22H45BO9P2 — CID 90167538
CID 90167538 (PubChem CID 90167538) has the molecular formula C22H45BO9P2 and a molecular weight of 526.35 g/mol.
| Compound Name | CID 90167538 |
|---|---|
| PubChem CID | 90167538 |
| Molecular Formula | C22H45BO9P2 |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CC(CC)(CC)OP(C)(=O)[C@](C)(CC)C(C)(C)OP(=O)(O)[C@@](C)(O)CC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H45BO9P2/c1-10-20(7,19(5,6)31-34(28,29)21(8,26)11-2)33(9,27)32-22(12-3,13-4)14-15-16(24)17(25)18(23)30-15/h15-18,24-26H,10-14H2,1-9H3,(H,28,29)/t15-,16-,17-,18-,20-,21-,33?/m1/s1 |
| InChIKey | QDLISQAFRCMHHF-ZGFNBITMSA-N |
| XLogP | 3.74 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|