C18H30FN2O9P — CID 90165276
[1-[(2R,3S,4R,5S)-5-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]-2-fluorobutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid (PubChem CID 90165276) has the molecular formula C18H30FN2O9P and a molecular weight of 468.42 g/mol. Its IUPAC name is [1-[(2R,3S,4R,5S)-5-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]-2-fluorobutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid.
| Compound Name | [1-[(2R,3S,4R,5S)-5-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]-2-fluorobutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 90165276 |
| Molecular Formula | C18H30FN2O9P |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [1-[(2R,3S,4R,5S)-5-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-3,4-dihydroxyoxolan-2-yl]-2-fluorobutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
| SMILES | CCC(F)(C[C@H]1O[C@@H](c2cn(C)c(=O)n(C)c2=O)[C@H](O)[C@@H]1O)OP(=O)(O)C(C)(O)CC |
| InChI | InChI=1S/C18H30FN2O9P/c1-6-17(3,26)31(27,28)30-18(19,7-2)8-11-12(22)13(23)14(29-11)10-9-20(4)16(25)21(5)15(10)24/h9,11-14,22-23,26H,6-8H2,1-5H3,(H,27,28)/t11-,12-,13-,14+,17?,18?/m1/s1 |
| InChIKey | VQABUVALFRFVBF-HMLPIZNXSA-N |
| XLogP | 0.03 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|