C20H28F2N3O8PS — CID 122544960
[1-[(2R,4S,5S)-5-(6,7-difluoro-8-oxo-2-sulfanylidene-9H-pyrimido[1,2-a]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid (PubChem CID 122544960) has the molecular formula C20H28F2N3O8PS and a molecular weight of 539.49 g/mol. Its IUPAC name is [1-[(2R,4S,5S)-5-(6,7-difluoro-8-oxo-2-sulfanylidene-9H-pyrimido[1,2-a]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid.
| Compound Name | [1-[(2R,4S,5S)-5-(6,7-difluoro-8-oxo-2-sulfanylidene-9H-pyrimido[1,2-a]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 122544960 |
| Molecular Formula | C20H28F2N3O8PS |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [1-[(2R,4S,5S)-5-(6,7-difluoro-8-oxo-2-sulfanylidene-9H-pyrimido[1,2-a]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
| SMILES | CCC(C)(C[C@H]1O[C@@H](c2cn3c(F)c(F)c(=O)[nH]c3nc2=S)[C@@H](O)C1O)OP(=O)(O)C(C)(O)CC |
| InChI | InChI=1S/C20H28F2N3O8PS/c1-5-19(3,33-34(30,31)20(4,29)6-2)7-10-12(26)13(27)14(32-10)9-8-25-15(22)11(21)16(28)23-18(25)24-17(9)35/h8,10,12-14,26-27,29H,5-7H2,1-4H3,(H,30,31)(H,23,24,28,35)/t10-,12?,13+,14+,19?,20?/m1/s1 |
| InChIKey | ACNMDRQGRFLISF-DVDVHLOISA-N |
| XLogP | 2.07 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|