C9H24O6P2 — CID 158654735
methoxy(propyl)phosphinic acid;2-methylbutan-2-ylphosphonic acid (PubChem CID 158654735) has the molecular formula C9H24O6P2 and a molecular weight of 290.23 g/mol. Its IUPAC name is methoxy(propyl)phosphinic acid;2-methylbutan-2-ylphosphonic acid.
| Compound Name | methoxy(propyl)phosphinic acid;2-methylbutan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 158654735 |
| Molecular Formula | C9H24O6P2 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methoxy(propyl)phosphinic acid;2-methylbutan-2-ylphosphonic acid |
| SMILES | CCC(C)(C)P(=O)(O)O.CCCP(=O)(O)OC |
| InChI | InChI=1S/C5H13O3P.C4H11O3P/c1-4-5(2,3)9(6,7)8;1-3-4-8(5,6)7-2/h4H2,1-3H3,(H2,6,7,8);3-4H2,1-2H3,(H,5,6) |
| InChIKey | IBZKIPMRPHXPFJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|