C11H26O6P2 — CID 13141546
[hydroxy(3-hydroxypentan-3-yl)phosphoryl]methyl-(3-hydroxypentan-3-yl)phosphinic acid (PubChem CID 13141546) has the molecular formula C11H26O6P2 and a molecular weight of 316.27 g/mol. Its IUPAC name is [hydroxy(3-hydroxypentan-3-yl)phosphoryl]methyl-(3-hydroxypentan-3-yl)phosphinic acid.
| Compound Name | [hydroxy(3-hydroxypentan-3-yl)phosphoryl]methyl-(3-hydroxypentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 13141546 |
| Molecular Formula | C11H26O6P2 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [hydroxy(3-hydroxypentan-3-yl)phosphoryl]methyl-(3-hydroxypentan-3-yl)phosphinic acid |
| SMILES | CCC(O)(CC)P(=O)(O)CP(=O)(O)C(O)(CC)CC |
| InChI | InChI=1S/C11H26O6P2/c1-5-10(12,6-2)18(14,15)9-19(16,17)11(13,7-3)8-4/h12-13H,5-9H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | NPVAAZOHRBAQML-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|