C12H29O4P — CID 157236281
2,2-diethylhexylphosphonic acid;ethanol (PubChem CID 157236281) has the molecular formula C12H29O4P and a molecular weight of 268.33 g/mol. Its IUPAC name is 2,2-diethylhexylphosphonic acid;ethanol.
| Compound Name | 2,2-diethylhexylphosphonic acid;ethanol |
|---|---|
| PubChem CID | 157236281 |
| Molecular Formula | C12H29O4P |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2,2-diethylhexylphosphonic acid;ethanol |
| SMILES | CCCCC(CC)(CC)CP(=O)(O)O.CCO |
| InChI | InChI=1S/C10H23O3P.C2H6O/c1-4-7-8-10(5-2,6-3)9-14(11,12)13;1-2-3/h4-9H2,1-3H3,(H2,11,12,13);3H,2H2,1H3 |
| InChIKey | AURDYSFGZQYKJY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|