C8H18O8P3-3 — CID 177074901
tert-butyl-[[tert-butyl(oxido)phosphoryl]oxy-oxidophosphoryl]oxyphosphinate (PubChem CID 177074901) has the molecular formula C8H18O8P3-3 and a molecular weight of 335.15 g/mol. Its IUPAC name is tert-butyl-[[tert-butyl(oxido)phosphoryl]oxy-oxidophosphoryl]oxyphosphinate.
| Compound Name | tert-butyl-[[tert-butyl(oxido)phosphoryl]oxy-oxidophosphoryl]oxyphosphinate |
|---|---|
| PubChem CID | 177074901 |
| Molecular Formula | C8H18O8P3-3 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | tert-butyl-[[tert-butyl(oxido)phosphoryl]oxy-oxidophosphoryl]oxyphosphinate |
| SMILES | CC(C)(C)P(=O)([O-])OP(=O)([O-])OP(=O)([O-])C(C)(C)C |
| InChI | InChI=1S/C8H21O8P3/c1-7(2,3)17(9,10)15-19(13,14)16-18(11,12)8(4,5)6/h1-6H3,(H,9,10)(H,11,12)(H,13,14)/p-3 |
| InChIKey | CTDQEXAWNWLLHG-UHFFFAOYSA-K |
| XLogP | 1.19 |
| TPSA | 138.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|