About barium(2+);bis(dimethyl phosphate)
barium(2+);bis(dimethyl phosphate) (PubChem CID 3835926) has the molecular formula C4H12BaO8P2
and a molecular weight of 387.41 g/mol. Its IUPAC name is barium(2+);bis(dimethyl phosphate).
Molecular Properties
| Compound Name | barium(2+);bis(dimethyl phosphate) |
| PubChem CID | 3835926 |
| Molecular Formula | C4H12BaO8P2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | barium(2+);bis(dimethyl phosphate) |
| SMILES | COP(=O)([O-])OC.COP(=O)([O-])OC.[Ba+2] |
| InChI | InChI=1S/2C2H7O4P.Ba/c2*1-5-7(3,4)6-2;/h2*1-2H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | WISHECRGNBABRA-UHFFFAOYSA-L |
| XLogP | -0.89 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(dimethyl phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(dimethyl phosphate)?
The IUPAC name of barium(2+);bis(dimethyl phosphate) (CID 3835926) is barium(2+);bis(dimethyl phosphate).
What is the SMILES notation for barium(2+);bis(dimethyl phosphate)?
The canonical SMILES for barium(2+);bis(dimethyl phosphate) is COP(=O)([O-])OC.COP(=O)([O-])OC.[Ba+2].
What is the InChIKey of barium(2+);bis(dimethyl phosphate)?
The InChIKey is WISHECRGNBABRA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H7O4P.Ba/c2*1-5-7(3,4)6-2;/h2*1-2H3,(H,3,4);/q;;+2/p-2.
What are the key properties of barium(2+);bis(dimethyl phosphate)?
barium(2+);bis(dimethyl phosphate) has a molecular weight of 387.41 g/mol, XLogP of -0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(dimethyl phosphate) is sourced from PubChem (CID 3835926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).