About dimethyl phosphate;1H-imidazol-3-ium
dimethyl phosphate;1H-imidazol-3-ium (PubChem CID 118692275) has the molecular formula C5H11N2O4P
and a molecular weight of 194.13 g/mol. Its IUPAC name is dimethyl phosphate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | dimethyl phosphate;1H-imidazol-3-ium |
| PubChem CID | 118692275 |
| Molecular Formula | C5H11N2O4P |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | dimethyl phosphate;1H-imidazol-3-ium |
| SMILES | COP(=O)([O-])OC.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C3H4N2.C2H7O4P/c1-2-5-3-4-1;1-5-7(3,4)6-2/h1-3H,(H,4,5);1-2H3,(H,3,4) |
| InChIKey | QGRUVEGMSJLNBR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl phosphate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl phosphate;1H-imidazol-3-ium?
The IUPAC name of dimethyl phosphate;1H-imidazol-3-ium (CID 118692275) is dimethyl phosphate;1H-imidazol-3-ium.
What is the SMILES notation for dimethyl phosphate;1H-imidazol-3-ium?
The canonical SMILES for dimethyl phosphate;1H-imidazol-3-ium is COP(=O)([O-])OC.c1c[nH+]c[nH]1.
What is the InChIKey of dimethyl phosphate;1H-imidazol-3-ium?
The InChIKey is QGRUVEGMSJLNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2H7O4P/c1-2-5-3-4-1;1-5-7(3,4)6-2/h1-3H,(H,4,5);1-2H3,(H,3,4).
What are the key properties of dimethyl phosphate;1H-imidazol-3-ium?
dimethyl phosphate;1H-imidazol-3-ium has a molecular weight of 194.13 g/mol, XLogP of -0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl phosphate;1H-imidazol-3-ium is sourced from PubChem (CID 118692275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).