About bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium
bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium (PubChem CID 142727002) has the molecular formula C23H27N2O4P
and a molecular weight of 426.45 g/mol. Its IUPAC name is bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium |
| PubChem CID | 142727002 |
| Molecular Formula | C23H27N2O4P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium |
| SMILES | Cc1cc(C)c(C(=O)P(=O)([O-])C(=O)c2c(C)cc(C)cc2C)c(C)c1.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C20H23O4P.C3H4N2/c1-11-7-13(3)17(14(4)8-11)19(21)25(23,24)20(22)18-15(5)9-12(2)10-16(18)6;1-2-5-3-4-1/h7-10H,1-6H3,(H,23,24);1-3H,(H,4,5) |
| InChIKey | WWZHBBNHZXHKKC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium?
The IUPAC name of bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium (CID 142727002) is bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium.
What is the SMILES notation for bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium?
The canonical SMILES for bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium is Cc1cc(C)c(C(=O)P(=O)([O-])C(=O)c2c(C)cc(C)cc2C)c(C)c1.c1c[nH+]c[nH]1.
What is the InChIKey of bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium?
The InChIKey is WWZHBBNHZXHKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23O4P.C3H4N2/c1-11-7-13(3)17(14(4)8-11)19(21)25(23,24)20(22)18-15(5)9-12(2)10-16(18)6;1-2-5-3-4-1/h7-10H,1-6H3,(H,23,24);1-3H,(H,4,5).
What are the key properties of bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium?
bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium has a molecular weight of 426.45 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium is sourced from PubChem (CID 142727002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).