C23H27N2O4P — CID 142727002
bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium (PubChem CID 142727002) has the molecular formula C23H27N2O4P and a molecular weight of 426.45 g/mol. Its IUPAC name is bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium.
| Compound Name | bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium |
|---|---|
| PubChem CID | 142727002 |
| Molecular Formula | C23H27N2O4P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | bis(2,4,6-trimethylbenzoyl)phosphinate;1H-imidazol-3-ium |
| SMILES | Cc1cc(C)c(C(=O)P(=O)([O-])C(=O)c2c(C)cc(C)cc2C)c(C)c1.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C20H23O4P.C3H4N2/c1-11-7-13(3)17(14(4)8-11)19(21)25(23,24)20(22)18-15(5)9-12(2)10-16(18)6;1-2-5-3-4-1/h7-10H,1-6H3,(H,23,24);1-3H,(H,4,5) |
| InChIKey | WWZHBBNHZXHKKC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|