About 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium
3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium (PubChem CID 71257721) has the molecular formula C9H12N2O7
and a molecular weight of 260.20 g/mol. Its IUPAC name is 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium |
| PubChem CID | 71257721 |
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)O.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C6H8O7.C3H4N2/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2-5-3-4-1/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-3H,(H,4,5) |
| InChIKey | JFLWZRZESMQKGI-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium?
The IUPAC name of 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium (CID 71257721) is 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium.
What is the SMILES notation for 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium?
The canonical SMILES for 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium is O=C([O-])CC(O)(CC(=O)O)C(=O)O.c1c[nH+]c[nH]1.
What is the InChIKey of 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium?
The InChIKey is JFLWZRZESMQKGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7.C3H4N2/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2-5-3-4-1/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-3H,(H,4,5).
What are the key properties of 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium?
3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium has a molecular weight of 260.20 g/mol, XLogP of -2.75, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxy-3,5-dihydroxy-5-oxopentanoate;1H-imidazol-3-ium is sourced from PubChem (CID 71257721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).