About dimethylphosphinate;methoxy(methyl)phosphinate
dimethylphosphinate;methoxy(methyl)phosphinate (PubChem CID 161267325) has the molecular formula C4H12O5P2-2
and a molecular weight of 202.08 g/mol. Its IUPAC name is dimethylphosphinate;methoxy(methyl)phosphinate.
Molecular Properties
| Compound Name | dimethylphosphinate;methoxy(methyl)phosphinate |
| PubChem CID | 161267325 |
| Molecular Formula | C4H12O5P2-2 |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | dimethylphosphinate;methoxy(methyl)phosphinate |
| SMILES | COP(C)(=O)[O-].CP(C)(=O)[O-] |
| InChI | InChI=1S/C2H7O3P.C2H7O2P/c1-5-6(2,3)4;1-5(2,3)4/h1-2H3,(H,3,4);1-2H3,(H,3,4)/p-2 |
| InChIKey | VDIXBGYRHPYVBV-UHFFFAOYSA-L |
| XLogP | -0.30 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphinate;methoxy(methyl)phosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphinate;methoxy(methyl)phosphinate?
The IUPAC name of dimethylphosphinate;methoxy(methyl)phosphinate (CID 161267325) is dimethylphosphinate;methoxy(methyl)phosphinate.
What is the SMILES notation for dimethylphosphinate;methoxy(methyl)phosphinate?
The canonical SMILES for dimethylphosphinate;methoxy(methyl)phosphinate is COP(C)(=O)[O-].CP(C)(=O)[O-].
What is the InChIKey of dimethylphosphinate;methoxy(methyl)phosphinate?
The InChIKey is VDIXBGYRHPYVBV-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H7O3P.C2H7O2P/c1-5-6(2,3)4;1-5(2,3)4/h1-2H3,(H,3,4);1-2H3,(H,3,4)/p-2.
What are the key properties of dimethylphosphinate;methoxy(methyl)phosphinate?
dimethylphosphinate;methoxy(methyl)phosphinate has a molecular weight of 202.08 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphinate;methoxy(methyl)phosphinate is sourced from PubChem (CID 161267325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).