AlO10P3Pb — CID 174925900
aluminum;lead(2+);[oxido(phosphonatooxy)phosphoryl] phosphate (PubChem CID 174925900) has the molecular formula AlO10P3Pb and a molecular weight of 487.09 g/mol. Its IUPAC name is aluminum;lead(2+);[oxido(phosphonatooxy)phosphoryl] phosphate.
| Compound Name | aluminum;lead(2+);[oxido(phosphonatooxy)phosphoryl] phosphate |
|---|---|
| PubChem CID | 174925900 |
| Molecular Formula | AlO10P3Pb |
| Molecular Weight | 487.09 g/mol |
| Exact Mass | 487.83 |
| IUPAC Name | aluminum;lead(2+);[oxido(phosphonatooxy)phosphoryl] phosphate |
| SMILES | O=P([O-])([O-])OP(=O)([O-])OP(=O)([O-])[O-].[Al+3].[Pb+2] |
| InChI | InChI=1S/Al.H5O10P3.Pb/c;1-11(2,3)9-13(7,8)10-12(4,5)6;/h;(H,7,8)(H2,1,2,3)(H2,4,5,6);/q+3;;+2/p-5 |
| InChIKey | FVXIAKOAWMJDGJ-UHFFFAOYSA-I |
| XLogP | -4.62 |
| TPSA | 184.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.09 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|