FO9P3-4 — CID 23418477
fluoro-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate (PubChem CID 23418477) has the molecular formula FO9P3-4 and a molecular weight of 255.91 g/mol. Its IUPAC name is fluoro-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate.
| Compound Name | fluoro-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate |
|---|---|
| PubChem CID | 23418477 |
| Molecular Formula | FO9P3-4 |
| Molecular Weight | 255.91 g/mol |
| Exact Mass | 255.88 |
| IUPAC Name | fluoro-[oxido(phosphonatooxy)phosphoryl]oxyphosphinate |
| SMILES | O=P([O-])([O-])OP(=O)([O-])OP(=O)([O-])F |
| InChI | InChI=1S/FH4O9P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,2,3)(H,7,8)(H2,4,5,6)/p-4 |
| InChIKey | YZOSPNZKHJZUFC-UHFFFAOYSA-J |
| XLogP | -2.25 |
| TPSA | 161.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.91 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|