About bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+)
bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) (PubChem CID 88773242) has the molecular formula C4H8Cl2O6P2Zr
and a molecular weight of 376.18 g/mol. Its IUPAC name is bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+).
Molecular Properties
| Compound Name | bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) |
| PubChem CID | 88773242 |
| Molecular Formula | C4H8Cl2O6P2Zr |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 373.82 |
| IUPAC Name | bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) |
| SMILES | O=P([O-])([O-])CCCl.O=P([O-])([O-])CCCl.[Zr+4] |
| InChI | InChI=1S/2C2H6ClO3P.Zr/c2*3-1-2-7(4,5)6;/h2*1-2H2,(H2,4,5,6);/q;;+4/p-4 |
| InChIKey | UFGCEMYULWISOU-UHFFFAOYSA-J |
| XLogP | -1.72 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+)?
The IUPAC name of bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) (CID 88773242) is bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+).
What is the SMILES notation for bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+)?
The canonical SMILES for bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) is O=P([O-])([O-])CCCl.O=P([O-])([O-])CCCl.[Zr+4].
What is the InChIKey of bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+)?
The InChIKey is UFGCEMYULWISOU-UHFFFAOYSA-J. The full InChI is InChI=1S/2C2H6ClO3P.Zr/c2*3-1-2-7(4,5)6;/h2*1-2H2,(H2,4,5,6);/q;;+4/p-4.
What are the key properties of bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+)?
bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) has a molecular weight of 376.18 g/mol, XLogP of -1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chloroethyl-dioxido-oxo-λ5-phosphane);zirconium(4+) is sourced from PubChem (CID 88773242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).