About diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane
diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane (PubChem CID 168655255) has the molecular formula C2H12ClN2O3P
and a molecular weight of 178.56 g/mol. Its IUPAC name is diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane.
Molecular Properties
| Compound Name | diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane |
| PubChem CID | 168655255 |
| Molecular Formula | C2H12ClN2O3P |
| Molecular Weight | 178.56 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane |
| SMILES | O=P([O-])([O-])CCCl.[NH4+].[NH4+] |
| InChI | InChI=1S/C2H6ClO3P.2H3N/c3-1-2-7(4,5)6;;/h1-2H2,(H2,4,5,6);2*1H3 |
| InChIKey | APFKEGYBIPZHSV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.56 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane?
The IUPAC name of diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane (CID 168655255) is diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane.
What is the SMILES notation for diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane?
The canonical SMILES for diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane is O=P([O-])([O-])CCCl.[NH4+].[NH4+].
What is the InChIKey of diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane?
The InChIKey is APFKEGYBIPZHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6ClO3P.2H3N/c3-1-2-7(4,5)6;;/h1-2H2,(H2,4,5,6);2*1H3.
What are the key properties of diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane?
diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane has a molecular weight of 178.56 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-chloroethyl-dioxido-oxo-λ5-phosphane is sourced from PubChem (CID 168655255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).