C3H14N3O9P3-4 — CID 139597306
diazanium;1-phosphonato-N,N-bis(phosphonatomethyl)methanamine (PubChem CID 139597306) has the molecular formula C3H14N3O9P3-4 and a molecular weight of 329.08 g/mol. Its IUPAC name is diazanium;1-phosphonato-N,N-bis(phosphonatomethyl)methanamine.
| Compound Name | diazanium;1-phosphonato-N,N-bis(phosphonatomethyl)methanamine |
|---|---|
| PubChem CID | 139597306 |
| Molecular Formula | C3H14N3O9P3-4 |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | diazanium;1-phosphonato-N,N-bis(phosphonatomethyl)methanamine |
| SMILES | O=P([O-])([O-])CN(CP(=O)([O-])[O-])CP(=O)([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C3H12NO9P3.2H3N/c5-14(6,7)1-4(2-15(8,9)10)3-16(11,12)13;;/h1-3H2,(H2,5,6,7)(H2,8,9,10)(H2,11,12,13);2*1H3/p-4 |
| InChIKey | UJWIANNBICCRFG-UHFFFAOYSA-J |
| XLogP | -4.35 |
| TPSA | 265.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|