C9H27N3O6P2-2 — CID 139595023
diazanium;N,N-bis(phosphonatomethyl)heptan-1-amine (PubChem CID 139595023) has the molecular formula C9H27N3O6P2-2 and a molecular weight of 335.28 g/mol. Its IUPAC name is diazanium;N,N-bis(phosphonatomethyl)heptan-1-amine.
| Compound Name | diazanium;N,N-bis(phosphonatomethyl)heptan-1-amine |
|---|---|
| PubChem CID | 139595023 |
| Molecular Formula | C9H27N3O6P2-2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | diazanium;N,N-bis(phosphonatomethyl)heptan-1-amine |
| SMILES | CCCCCCCN(CP(=O)([O-])[O-])CP(=O)([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C9H23NO6P2.2H3N/c1-2-3-4-5-6-7-10(8-17(11,12)13)9-18(14,15)16;;/h2-9H2,1H3,(H2,11,12,13)(H2,14,15,16);2*1H3/p-2 |
| InChIKey | GCKPSOJHDQNKOM-UHFFFAOYSA-L |
| XLogP | -0.25 |
| TPSA | 202.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|