C10H21NNa2O6P2-2 — CID 139594264
disodium;N,N-bis(phosphonatomethyl)octan-1-amine (PubChem CID 139594264) has the molecular formula C10H21NNa2O6P2-2 and a molecular weight of 359.21 g/mol. Its IUPAC name is disodium;N,N-bis(phosphonatomethyl)octan-1-amine.
| Compound Name | disodium;N,N-bis(phosphonatomethyl)octan-1-amine |
|---|---|
| PubChem CID | 139594264 |
| Molecular Formula | C10H21NNa2O6P2-2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | disodium;N,N-bis(phosphonatomethyl)octan-1-amine |
| SMILES | CCCCCCCCN(CP(=O)([O-])[O-])CP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H25NO6P2.2Na/c1-2-3-4-5-6-7-8-11(9-18(12,13)14)10-19(15,16)17;;/h2-10H2,1H3,(H2,12,13,14)(H2,15,16,17);;/q;2*+1/p-4 |
| InChIKey | AYAHNBSQGCKBAL-UHFFFAOYSA-J |
| XLogP | -6.60 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|