C4H17N3O7P2-2 — CID 139597526
diazanium;2-[bis(phosphonatomethyl)amino]ethanol (PubChem CID 139597526) has the molecular formula C4H17N3O7P2-2 and a molecular weight of 281.14 g/mol. Its IUPAC name is diazanium;2-[bis(phosphonatomethyl)amino]ethanol.
| Compound Name | diazanium;2-[bis(phosphonatomethyl)amino]ethanol |
|---|---|
| PubChem CID | 139597526 |
| Molecular Formula | C4H17N3O7P2-2 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | diazanium;2-[bis(phosphonatomethyl)amino]ethanol |
| SMILES | O=P([O-])([O-])CN(CCO)CP(=O)([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H13NO7P2.2H3N/c6-2-1-5(3-13(7,8)9)4-14(10,11)12;;/h6H,1-4H2,(H2,7,8,9)(H2,10,11,12);2*1H3/p-2 |
| InChIKey | VSBAYBKIVFSFPR-UHFFFAOYSA-L |
| XLogP | -3.22 |
| TPSA | 222.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|