About 2-aminoethanol;iron(3+);phosphate
2-aminoethanol;iron(3+);phosphate (PubChem CID 87771610) has the molecular formula C2H7FeNO5P
and a molecular weight of 211.90 g/mol. Its IUPAC name is 2-aminoethanol;iron(3+);phosphate.
Molecular Properties
| Compound Name | 2-aminoethanol;iron(3+);phosphate |
| PubChem CID | 87771610 |
| Molecular Formula | C2H7FeNO5P |
| Molecular Weight | 211.90 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | 2-aminoethanol;iron(3+);phosphate |
| SMILES | NCCO.O=P([O-])([O-])[O-].[Fe+3] |
| InChI | InChI=1S/C2H7NO.Fe.H3O4P/c3-1-2-4;;1-5(2,3)4/h4H,1-3H2;;(H3,1,2,3,4)/q;+3;/p-3 |
| InChIKey | PWDSDSDPEDHLDG-UHFFFAOYSA-K |
| XLogP | -3.89 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.90 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;iron(3+);phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;iron(3+);phosphate?
The IUPAC name of 2-aminoethanol;iron(3+);phosphate (CID 87771610) is 2-aminoethanol;iron(3+);phosphate.
What is the SMILES notation for 2-aminoethanol;iron(3+);phosphate?
The canonical SMILES for 2-aminoethanol;iron(3+);phosphate is NCCO.O=P([O-])([O-])[O-].[Fe+3].
What is the InChIKey of 2-aminoethanol;iron(3+);phosphate?
The InChIKey is PWDSDSDPEDHLDG-UHFFFAOYSA-K. The full InChI is InChI=1S/C2H7NO.Fe.H3O4P/c3-1-2-4;;1-5(2,3)4/h4H,1-3H2;;(H3,1,2,3,4)/q;+3;/p-3.
What are the key properties of 2-aminoethanol;iron(3+);phosphate?
2-aminoethanol;iron(3+);phosphate has a molecular weight of 211.90 g/mol, XLogP of -3.89, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;iron(3+);phosphate is sourced from PubChem (CID 87771610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).