C2H9N2O4PPt — CID 175317536
ethane-1,2-diamine;hydrogen phosphate;platinum(2+) (PubChem CID 175317536) has the molecular formula C2H9N2O4PPt and a molecular weight of 351.16 g/mol. Its IUPAC name is ethane-1,2-diamine;hydrogen phosphate;platinum(2+).
| Compound Name | ethane-1,2-diamine;hydrogen phosphate;platinum(2+) |
|---|---|
| PubChem CID | 175317536 |
| Molecular Formula | C2H9N2O4PPt |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | ethane-1,2-diamine;hydrogen phosphate;platinum(2+) |
| SMILES | NCCN.O=P([O-])([O-])O.[Pt+2] |
| InChI | InChI=1S/C2H8N2.H3O4P.Pt/c3-1-2-4;1-5(2,3)4;/h1-4H2;(H3,1,2,3,4);/q;;+2/p-2 |
| InChIKey | UHRJZQGRNWHATM-UHFFFAOYSA-L |
| XLogP | -3.29 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|