C7H11Cl2O3P-2 — CID 22756743
[5-chloro-3-(2-chloroethyl)pent-1-en-3-yl]-dioxido-oxo-λ5-phosphane (PubChem CID 22756743) has the molecular formula C7H11Cl2O3P-2 and a molecular weight of 245.04 g/mol. Its IUPAC name is [5-chloro-3-(2-chloroethyl)pent-1-en-3-yl]-dioxido-oxo-λ5-phosphane.
| Compound Name | [5-chloro-3-(2-chloroethyl)pent-1-en-3-yl]-dioxido-oxo-λ5-phosphane |
|---|---|
| PubChem CID | 22756743 |
| Molecular Formula | C7H11Cl2O3P-2 |
| Molecular Weight | 245.04 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | [5-chloro-3-(2-chloroethyl)pent-1-en-3-yl]-dioxido-oxo-λ5-phosphane |
| SMILES | C=CC(CCCl)(CCCl)P(=O)([O-])[O-] |
| InChI | InChI=1S/C7H13Cl2O3P/c1-2-7(3-5-8,4-6-9)13(10,11)12/h2H,1,3-6H2,(H2,10,11,12)/p-2 |
| InChIKey | RFKQDAPROAHGMG-UHFFFAOYSA-L |
| XLogP | 1.08 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.04 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|