C9H11Cl5F6 — CID 159816645
3-chloro-1,1,1-trifluoropropane;1,1,1,3-tetrachloropropane;3,3,3-trifluoroprop-1-ene (PubChem CID 159816645) has the molecular formula C9H11Cl5F6 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-chloro-1,1,1-trifluoropropane;1,1,1,3-tetrachloropropane;3,3,3-trifluoroprop-1-ene.
| Compound Name | 3-chloro-1,1,1-trifluoropropane;1,1,1,3-tetrachloropropane;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 159816645 |
| Molecular Formula | C9H11Cl5F6 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 407.92 |
| IUPAC Name | 3-chloro-1,1,1-trifluoropropane;1,1,1,3-tetrachloropropane;3,3,3-trifluoroprop-1-ene |
| SMILES | C=CC(F)(F)F.ClCCC(Cl)(Cl)Cl.FC(F)(F)CCCl |
| InChI | InChI=1S/C3H4Cl4.C3H4ClF3.C3H3F3/c2*4-2-1-3(5,6)7;1-2-3(4,5)6/h2*1-2H2;2H,1H2 |
| InChIKey | NLRUIMWHJWZQQQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|